C22H30ClN7O2 — CID 68950005
1,4,5-tris(2-aminoethylamino)-8-(2-chloroethylamino)anthracene-9,10-dione (PubChem CID 68950005) has the molecular formula C22H30ClN7O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 1,4,5-tris(2-aminoethylamino)-8-(2-chloroethylamino)anthracene-9,10-dione.
| Compound Name | 1,4,5-tris(2-aminoethylamino)-8-(2-chloroethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 68950005 |
| Molecular Formula | C22H30ClN7O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1,4,5-tris(2-aminoethylamino)-8-(2-chloroethylamino)anthracene-9,10-dione |
| SMILES | NCCNc1ccc(NCCN)c2c1C(=O)c1c(NCCN)ccc(NCCCl)c1C2=O |
| InChI | InChI=1S/C22H30ClN7O2/c23-5-9-27-13-1-2-14(28-10-6-24)18-17(13)21(31)19-15(29-11-7-25)3-4-16(30-12-8-26)20(19)22(18)32/h1-4,27-30H,5-12,24-26H2 |
| InChIKey | YIMCCAZVGVBOLP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|