C24H28N6O — CID 68950619
2-[3-(2-butan-2-yl-6-naphthalen-2-yl-3-oxo-2H-imidazo[1,2-a]pyrazin-8-yl)propyl]guanidine (PubChem CID 68950619) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[3-(2-butan-2-yl-6-naphthalen-2-yl-3-oxo-2H-imidazo[1,2-a]pyrazin-8-yl)propyl]guanidine.
| Compound Name | 2-[3-(2-butan-2-yl-6-naphthalen-2-yl-3-oxo-2H-imidazo[1,2-a]pyrazin-8-yl)propyl]guanidine |
|---|---|
| PubChem CID | 68950619 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-[3-(2-butan-2-yl-6-naphthalen-2-yl-3-oxo-2H-imidazo[1,2-a]pyrazin-8-yl)propyl]guanidine |
| SMILES | CCC(C)C1N=C2C(CCCN=C(N)N)=NC(c3ccc4ccccc4c3)=CN2C1=O |
| InChI | InChI=1S/C24H28N6O/c1-3-15(2)21-23(31)30-14-20(18-11-10-16-7-4-5-8-17(16)13-18)28-19(22(30)29-21)9-6-12-27-24(25)26/h4-5,7-8,10-11,13-15,21H,3,6,9,12H2,1-2H3,(H4,25,26,27) |
| InChIKey | OLFNFOXTYVOPCC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|