C38H52F2O3Si — CID 68950951
methyl (E)-7-[(1R,2R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3,3-difluorooct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate (PubChem CID 68950951) has the molecular formula C38H52F2O3Si and a molecular weight of 622.91 g/mol. Its IUPAC name is methyl (E)-7-[(1R,2R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3,3-difluorooct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[(1R,2R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3,3-difluorooct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68950951 |
| Molecular Formula | C38H52F2O3Si |
| Molecular Weight | 622.91 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | methyl (E)-7-[(1R,2R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3,3-difluorooct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate |
| SMILES | C=C1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C/C=C/CCCC(=O)OC)[C@H]1/C=C/C(F)(F)CCCCC |
| InChI | InChI=1S/C38H52F2O3Si/c1-7-8-19-27-38(39,40)28-26-33-30(2)29-35(34(33)24-17-9-10-18-25-36(41)42-6)43-44(37(3,4)5,31-20-13-11-14-21-31)32-22-15-12-16-23-32/h9,11-17,20-23,26,28,33-35H,2,7-8,10,18-19,24-25,27,29H2,1,3-6H3/b17-9+,28-26+/t33-,34+,35-/m0/s1 |
| InChIKey | YHJHSMXLYDEZRB-QBRGOYBBSA-N |
| XLogP | 9.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.91 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|