C23H42O7 — CID 68951335
(4aR,6R,7R,8R,8aR)-8-[(3R)-3-methoxydecoxy]-2,2-dimethyl-6-[(E)-prop-1-enoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 68951335) has the molecular formula C23H42O7 and a molecular weight of 430.58 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aR)-8-[(3R)-3-methoxydecoxy]-2,2-dimethyl-6-[(E)-prop-1-enoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,6R,7R,8R,8aR)-8-[(3R)-3-methoxydecoxy]-2,2-dimethyl-6-[(E)-prop-1-enoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 68951335 |
| Molecular Formula | C23H42O7 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (4aR,6R,7R,8R,8aR)-8-[(3R)-3-methoxydecoxy]-2,2-dimethyl-6-[(E)-prop-1-enoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | C/C=C/O[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](OCC[C@@H](CCCCCCC)OC)[C@H]1O |
| InChI | InChI=1S/C23H42O7/c1-6-8-9-10-11-12-17(25-5)13-15-26-21-19(24)22(27-14-7-2)29-18-16-28-23(3,4)30-20(18)21/h7,14,17-22,24H,6,8-13,15-16H2,1-5H3/b14-7+/t17-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | ZPKISIMABOAXGN-RYCZYQDRSA-N |
| XLogP | 3.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|