C41H82O7Si — CID 68951351
(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-3-[(Z)-octadec-11-enoxy]oxane-2,5-diol (PubChem CID 68951351) has the molecular formula C41H82O7Si and a molecular weight of 715.19 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-3-[(Z)-octadec-11-enoxy]oxane-2,5-diol.
| Compound Name | (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-3-[(Z)-octadec-11-enoxy]oxane-2,5-diol |
|---|---|
| PubChem CID | 68951351 |
| Molecular Formula | C41H82O7Si |
| Molecular Weight | 715.19 g/mol |
| Exact Mass | 714.58 |
| IUPAC Name | (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-3-[(Z)-octadec-11-enoxy]oxane-2,5-diol |
| SMILES | CCCCCC/C=C\CCCCCCCCCCO[C@H]1C(O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OCC[C@@H](CCCCCCC)OC |
| InChI | InChI=1S/C41H82O7Si/c1-9-11-13-15-16-17-18-19-20-21-22-23-24-25-27-29-32-45-39-38(46-33-31-35(44-6)30-28-26-14-12-10-2)37(42)36(48-40(39)43)34-47-49(7,8)41(3,4)5/h17-18,35-40,42-43H,9-16,19-34H2,1-8H3/b18-17-/t35-,36-,37-,38+,39-,40?/m1/s1 |
| InChIKey | MRCDGZRZRXEGQV-LGCGQUEXSA-N |
| XLogP | 10.66 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.19 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|