About azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid
azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid (PubChem CID 68952110) has the molecular formula C4H8N2O3S
and a molecular weight of 164.19 g/mol. Its IUPAC name is azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid.
Molecular Properties
| Compound Name | azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid |
| PubChem CID | 68952110 |
| Molecular Formula | C4H8N2O3S |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid |
| SMILES | N.O=C(O)N1C=C(O)SC1 |
| InChI | InChI=1S/C4H5NO3S.H3N/c6-3-1-5(2-9-3)4(7)8;/h1,6H,2H2,(H,7,8);1H3 |
| InChIKey | RYAHWPPSWYUBBV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid?
The IUPAC name of azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid (CID 68952110) is azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid.
What is the SMILES notation for azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid?
The canonical SMILES for azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid is N.O=C(O)N1C=C(O)SC1.
What is the InChIKey of azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid?
The InChIKey is RYAHWPPSWYUBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3S.H3N/c6-3-1-5(2-9-3)4(7)8;/h1,6H,2H2,(H,7,8);1H3.
What are the key properties of azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid?
azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid has a molecular weight of 164.19 g/mol, XLogP of 1.19, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-hydroxy-2H-1,3-thiazole-3-carboxylic acid is sourced from PubChem (CID 68952110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).