About [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea
[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea (PubChem CID 6895242) has the molecular formula C17H15N5O
and a molecular weight of 305.34 g/mol. Its IUPAC name is [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea |
| PubChem CID | 6895242 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H15N5O/c18-17(23)20-19-11-14-12-22(15-9-5-2-6-10-15)21-16(14)13-7-3-1-4-8-13/h1-12H,(H3,18,20,23)/b19-11+ |
| InChIKey | GANUFCGHYJZVLE-YBFXNURJSA-N |
| XLogP | 2.54 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea?
The IUPAC name of [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea (CID 6895242) is [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea.
What is the SMILES notation for [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea?
The canonical SMILES for [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea is NC(=O)N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea?
The InChIKey is GANUFCGHYJZVLE-YBFXNURJSA-N. The full InChI is InChI=1S/C17H15N5O/c18-17(23)20-19-11-14-12-22(15-9-5-2-6-10-15)21-16(14)13-7-3-1-4-8-13/h1-12H,(H3,18,20,23)/b19-11+.
What are the key properties of [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea?
[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea has a molecular weight of 305.34 g/mol, XLogP of 2.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]urea is sourced from PubChem (CID 6895242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).