About 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine
5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine (PubChem CID 68952459) has the molecular formula C16H28N6
and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine.
Molecular Properties
| Compound Name | 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine |
| PubChem CID | 68952459 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine |
| SMILES | CCC(C)C1=C(C)N(N)C(n2cccn2)N=C1N(CC)CC |
| InChI | InChI=1S/C16H28N6/c1-6-12(4)14-13(5)22(17)16(21-11-9-10-18-21)19-15(14)20(7-2)8-3/h9-12,16H,6-8,17H2,1-5H3 |
| InChIKey | IIEFZBCKNJSBCK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine?
The IUPAC name of 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine (CID 68952459) is 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine.
What is the SMILES notation for 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine?
The canonical SMILES for 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine is CCC(C)C1=C(C)N(N)C(n2cccn2)N=C1N(CC)CC.
What is the InChIKey of 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine?
The InChIKey is IIEFZBCKNJSBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N6/c1-6-12(4)14-13(5)22(17)16(21-11-9-10-18-21)19-15(14)20(7-2)8-3/h9-12,16H,6-8,17H2,1-5H3.
What are the key properties of 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine?
5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine has a molecular weight of 304.44 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-4-N,4-N-diethyl-6-methyl-2-pyrazol-1-yl-2H-pyrimidine-1,4-diamine is sourced from PubChem (CID 68952459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).