C13H23N3 — CID 68952487
1-(1,5,6,7,8,8a-hexahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 68952487) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 1-(1,5,6,7,8,8a-hexahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | 1-(1,5,6,7,8,8a-hexahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 68952487 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 1-(1,5,6,7,8,8a-hexahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | NCCCC(N)C1CCCC2=CC=CNC21 |
| InChI | InChI=1S/C13H23N3/c14-8-2-7-12(15)11-6-1-4-10-5-3-9-16-13(10)11/h3,5,9,11-13,16H,1-2,4,6-8,14-15H2 |
| InChIKey | SNDVLFIUSIZFEJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |