C18H15Br2N3O3 — CID 6895275
(3R,4S)-N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 6895275) has the molecular formula C18H15Br2N3O3 and a molecular weight of 481.14 g/mol. Its IUPAC name is (3R,4S)-N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 6895275 |
| Molecular Formula | C18H15Br2N3O3 |
| Molecular Weight | 481.14 g/mol |
| Exact Mass | 478.95 |
| IUPAC Name | (3R,4S)-N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C1NC[C@H](c2ccccc2)[C@H]1C(=O)N/N=C/c1cc(O)c(Br)cc1Br |
| InChI | InChI=1S/C18H15Br2N3O3/c19-13-7-14(20)15(24)6-11(13)8-22-23-18(26)16-12(9-21-17(16)25)10-4-2-1-3-5-10/h1-8,12,16,24H,9H2,(H,21,25)(H,23,26)/b22-8+/t12-,16-/m1/s1 |
| InChIKey | HVRYBWKLMSOMQF-FTGAVUAMSA-N |
| XLogP | 2.90 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|