C18H16ClN3O — CID 68952979
3-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-5-(4-pyridin-2-ylbut-3-ynyl)-1,2,4-oxadiazole (PubChem CID 68952979) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-5-(4-pyridin-2-ylbut-3-ynyl)-1,2,4-oxadiazole.
| Compound Name | 3-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-5-(4-pyridin-2-ylbut-3-ynyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 68952979 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-5-(4-pyridin-2-ylbut-3-ynyl)-1,2,4-oxadiazole |
| SMILES | CC1(Cl)C=CC=CC1c1noc(CCC#Cc2ccccn2)n1 |
| InChI | InChI=1S/C18H16ClN3O/c1-18(19)12-6-4-10-15(18)17-21-16(23-22-17)11-3-2-8-14-9-5-7-13-20-14/h4-7,9-10,12-13,15H,3,11H2,1H3 |
| InChIKey | GDQGDFFOFGQWCU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|