C19H27N3O3S — CID 68954073
9-[3-(dimethylsulfamoyl)propyl]-N-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 68954073) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 9-[3-(dimethylsulfamoyl)propyl]-N-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-[3-(dimethylsulfamoyl)propyl]-N-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 68954073 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 9-[3-(dimethylsulfamoyl)propyl]-N-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)c1c(n2CCCS(=O)(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C19H27N3O3S/c1-20-19(23)14-9-10-18-16(13-14)15-7-4-5-8-17(15)22(18)11-6-12-26(24,25)21(2)3/h9-10,13H,4-8,11-12H2,1-3H3,(H,20,23) |
| InChIKey | USZKXFCFFNHCPP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|