C15H16O4 — CID 68954552
8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,7,9-triene-7-carboxylic acid (PubChem CID 68954552) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,7,9-triene-7-carboxylic acid.
| Compound Name | 8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,7,9-triene-7-carboxylic acid |
|---|---|
| PubChem CID | 68954552 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,7,9-triene-7-carboxylic acid |
| SMILES | C=CCOC(=O)C1=C(C(=O)O)C2C=CC1CC=CC2 |
| InChI | InChI=1S/C15H16O4/c1-2-9-19-15(18)13-11-6-4-3-5-10(7-8-11)12(13)14(16)17/h2-4,7-8,10-11H,1,5-6,9H2,(H,16,17) |
| InChIKey | NCPQGZCXWGGWLW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|