C23H16F5N3O3 — CID 68954606
[1-[4-[6-[(2,4-difluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenyl]-2-hydroxyethyl] 2,2,2-trifluoroacetate (PubChem CID 68954606) has the molecular formula C23H16F5N3O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is [1-[4-[6-[(2,4-difluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenyl]-2-hydroxyethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[4-[6-[(2,4-difluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenyl]-2-hydroxyethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68954606 |
| Molecular Formula | C23H16F5N3O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [1-[4-[6-[(2,4-difluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenyl]-2-hydroxyethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(CO)c1ccc(-c2nnc3ccc(Cc4ccc(F)cc4F)cn23)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H16F5N3O3/c24-17-7-6-16(18(25)10-17)9-13-1-8-20-29-30-21(31(20)11-13)15-4-2-14(3-5-15)19(12-32)34-22(33)23(26,27)28/h1-8,10-11,19,32H,9,12H2 |
| InChIKey | RAWJTAIEBJLYJJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |