C22H20BrClN2O2 — CID 68956426
(3S,4'R,6'S)-6-bromo-6'-but-1-en-2-yl-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 68956426) has the molecular formula C22H20BrClN2O2 and a molecular weight of 459.77 g/mol. Its IUPAC name is (3S,4'R,6'S)-6-bromo-6'-but-1-en-2-yl-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3S,4'R,6'S)-6-bromo-6'-but-1-en-2-yl-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 68956426 |
| Molecular Formula | C22H20BrClN2O2 |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (3S,4'R,6'S)-6-bromo-6'-but-1-en-2-yl-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C=C(CC)[C@@H]1NC(=O)C[C@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Br)ccc12 |
| InChI | InChI=1S/C22H20BrClN2O2/c1-3-12(2)20-22(16-8-7-14(23)10-18(16)25-21(22)28)17(11-19(27)26-20)13-5-4-6-15(24)9-13/h4-10,17,20H,2-3,11H2,1H3,(H,25,28)(H,26,27)/t17-,20+,22-/m1/s1 |
| InChIKey | GDLGRMKDFCURGM-PIPMEXSNSA-N |
| XLogP | 4.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|