About bis(benzene-1,3-diol);triazine
bis(benzene-1,3-diol);triazine (PubChem CID 68957411) has the molecular formula C15H15N3O4
and a molecular weight of 301.30 g/mol. Its IUPAC name is bis(benzene-1,3-diol);triazine.
Molecular Properties
| Compound Name | bis(benzene-1,3-diol);triazine |
| PubChem CID | 68957411 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | bis(benzene-1,3-diol);triazine |
| SMILES | Oc1cccc(O)c1.Oc1cccc(O)c1.c1cnnnc1 |
| InChI | InChI=1S/2C6H6O2.C3H3N3/c2*7-5-2-1-3-6(8)4-5;1-2-4-6-5-3-1/h2*1-4,7-8H;1-3H |
| InChIKey | BWVVSADQOOQISG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(benzene-1,3-diol);triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,3-diol);triazine?
The IUPAC name of bis(benzene-1,3-diol);triazine (CID 68957411) is bis(benzene-1,3-diol);triazine.
What is the SMILES notation for bis(benzene-1,3-diol);triazine?
The canonical SMILES for bis(benzene-1,3-diol);triazine is Oc1cccc(O)c1.Oc1cccc(O)c1.c1cnnnc1.
What is the InChIKey of bis(benzene-1,3-diol);triazine?
The InChIKey is BWVVSADQOOQISG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O2.C3H3N3/c2*7-5-2-1-3-6(8)4-5;1-2-4-6-5-3-1/h2*1-4,7-8H;1-3H.
What are the key properties of bis(benzene-1,3-diol);triazine?
bis(benzene-1,3-diol);triazine has a molecular weight of 301.30 g/mol, XLogP of 2.07, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,3-diol);triazine is sourced from PubChem (CID 68957411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).