About methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate
methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate (PubChem CID 68957665) has the molecular formula C28H31NO5
and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate.
Molecular Properties
| Compound Name | methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate |
| PubChem CID | 68957665 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate |
| SMILES | COCOc1ccc(Cc2c(C)cc(C(=O)OC)cc2C)cc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C28H31NO5/c1-19-14-23(28(31)33-4)15-20(2)24(19)16-22-10-11-26(34-18-32-3)25(17-22)27(30)29-13-12-21-8-6-5-7-9-21/h5-11,14-15,17H,12-13,16,18H2,1-4H3,(H,29,30) |
| InChIKey | HOMIBBRVSLBIHE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate?
The IUPAC name of methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate (CID 68957665) is methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate.
What is the SMILES notation for methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate?
The canonical SMILES for methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate is COCOc1ccc(Cc2c(C)cc(C(=O)OC)cc2C)cc1C(=O)NCCc1ccccc1.
What is the InChIKey of methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate?
The InChIKey is HOMIBBRVSLBIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NO5/c1-19-14-23(28(31)33-4)15-20(2)24(19)16-22-10-11-26(34-18-32-3)25(17-22)27(30)29-13-12-21-8-6-5-7-9-21/h5-11,14-15,17H,12-13,16,18H2,1-4H3,(H,29,30).
What are the key properties of methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate?
methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate has a molecular weight of 461.56 g/mol, XLogP of 4.64, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[4-(methoxymethoxy)-3-(2-phenylethylcarbamoyl)phenyl]methyl]-3,5-dimethylbenzoate is sourced from PubChem (CID 68957665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).