C26H33BN7O4 — CID 68957814
CID 68957814 (PubChem CID 68957814) has the molecular formula C26H33BN7O4 and a molecular weight of 518.41 g/mol.
| Compound Name | CID 68957814 |
|---|---|
| PubChem CID | 68957814 |
| Molecular Formula | C26H33BN7O4 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | — |
| SMILES | CC(C)NC(=O)c1cccc(-c2nn(C)c3nc(N)ncc23)c1.CC(C)NC(=O)c1ccccc1.O[B]O |
| InChI | InChI=1S/C16H18N6O.C10H13NO.BH2O2/c1-9(2)19-15(23)11-6-4-5-10(7-11)13-12-8-18-16(17)20-14(12)22(3)21-13;1-8(2)11-10(12)9-6-4-3-5-7-9;2-1-3/h4-9H,1-3H3,(H,19,23)(H2,17,18,20);3-8H,1-2H3,(H,11,12);2-3H |
| InChIKey | ZVWOTKRPYVROOA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 168.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|