C27H34Cl2N4O8 — CID 68958020
N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-propan-2-ylpiperidine-4-carboxamide (PubChem CID 68958020) has the molecular formula C27H34Cl2N4O8 and a molecular weight of 613.50 g/mol. Its IUPAC name is N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 68958020 |
| Molecular Formula | C27H34Cl2N4O8 |
| Molecular Weight | 613.50 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)N1CCC(C(=O)Nc2c(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C27H34Cl2N4O8/c1-13(2)33-7-5-14(6-8-33)25(38)32-21-17(26(39)31-20-4-3-15(28)11-30-20)9-16(29)10-18(21)40-27-24(37)23(36)22(35)19(12-34)41-27/h3-4,9-11,13-14,19,22-24,27,34-37H,5-8,12H2,1-2H3,(H,32,38)(H,30,31,39)/t19-,22-,23+,24-,27?/m1/s1 |
| InChIKey | YEFPLQUSJSPNFH-PZKZUJNYSA-N |
| XLogP | 1.88 |
| TPSA | 173.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |