C13H18ClIN2O2 — CID 68959069
2-amino-3-hydroxy-3-(3-iodophenyl)-1-pyrrolidin-1-ylpropan-1-one;hydrochloride (PubChem CID 68959069) has the molecular formula C13H18ClIN2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 2-amino-3-hydroxy-3-(3-iodophenyl)-1-pyrrolidin-1-ylpropan-1-one;hydrochloride.
| Compound Name | 2-amino-3-hydroxy-3-(3-iodophenyl)-1-pyrrolidin-1-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 68959069 |
| Molecular Formula | C13H18ClIN2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 2-amino-3-hydroxy-3-(3-iodophenyl)-1-pyrrolidin-1-ylpropan-1-one;hydrochloride |
| SMILES | Cl.NC(C(=O)N1CCCC1)C(O)c1cccc(I)c1 |
| InChI | InChI=1S/C13H17IN2O2.ClH/c14-10-5-3-4-9(8-10)12(17)11(15)13(18)16-6-1-2-7-16;/h3-5,8,11-12,17H,1-2,6-7,15H2;1H |
| InChIKey | WQSBVQWKOWTPRU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|