C9H7Cl2N3O — CID 68959507
3-(3,5-dichlorophenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 68959507) has the molecular formula C9H7Cl2N3O and a molecular weight of 244.08 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 3-(3,5-dichlorophenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 68959507 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | O=C1CN=C(c2cc(Cl)cc(Cl)c2)NN1 |
| InChI | InChI=1S/C9H7Cl2N3O/c10-6-1-5(2-7(11)3-6)9-12-4-8(15)13-14-9/h1-3H,4H2,(H,12,14)(H,13,15) |
| InChIKey | MPFSXKCVNOIRDK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |