About (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride
(1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride (PubChem CID 68959767) has the molecular formula C14H16Cl2FNO
and a molecular weight of 304.19 g/mol. Its IUPAC name is (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride.
Molecular Properties
| Compound Name | (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride |
| PubChem CID | 68959767 |
| Molecular Formula | C14H16Cl2FNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride |
| SMILES | CN1[C@@H]2C=C[C@H]1CC(Oc1ccc(F)c(Cl)c1)C2.Cl |
| InChI | InChI=1S/C14H15ClFNO.ClH/c1-17-9-2-3-10(17)7-12(6-9)18-11-4-5-14(16)13(15)8-11;/h2-5,8-10,12H,6-7H2,1H3;1H/t9-,10+,12?; |
| InChIKey | OKUQMCPBHFHIQQ-YJWYWUHLSA-N |
| XLogP | 3.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride?
The IUPAC name of (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride (CID 68959767) is (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride.
What is the SMILES notation for (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride?
The canonical SMILES for (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride is CN1[C@@H]2C=C[C@H]1CC(Oc1ccc(F)c(Cl)c1)C2.Cl.
What is the InChIKey of (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride?
The InChIKey is OKUQMCPBHFHIQQ-YJWYWUHLSA-N. The full InChI is InChI=1S/C14H15ClFNO.ClH/c1-17-9-2-3-10(17)7-12(6-9)18-11-4-5-14(16)13(15)8-11;/h2-5,8-10,12H,6-7H2,1H3;1H/t9-,10+,12?;.
What are the key properties of (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride?
(1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride has a molecular weight of 304.19 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-(3-chloro-4-fluorophenoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-ene;hydrochloride is sourced from PubChem (CID 68959767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).