C13H24N2O6 — CID 68959859
[(2R,3S,4S,5S)-2,3,4-trihydroxy-5-(piperidin-1-ylmethyl)oxolan-2-yl]methyl N-methylcarbamate (PubChem CID 68959859) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-2,3,4-trihydroxy-5-(piperidin-1-ylmethyl)oxolan-2-yl]methyl N-methylcarbamate.
| Compound Name | [(2R,3S,4S,5S)-2,3,4-trihydroxy-5-(piperidin-1-ylmethyl)oxolan-2-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 68959859 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [(2R,3S,4S,5S)-2,3,4-trihydroxy-5-(piperidin-1-ylmethyl)oxolan-2-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@@]1(O)O[C@@H](CN2CCCCC2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H24N2O6/c1-14-12(18)20-8-13(19)11(17)10(16)9(21-13)7-15-5-3-2-4-6-15/h9-11,16-17,19H,2-8H2,1H3,(H,14,18)/t9-,10+,11-,13+/m0/s1 |
| InChIKey | RMOYYBIPYVDDAC-SRRSOLGSSA-N |
| XLogP | -1.36 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |