C24H31N3O4S — CID 68959952
N-[(2R)-5-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 68959952) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[(2R)-5-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[(2R)-5-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 68959952 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[(2R)-5-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | Cc1ccc(N2CCN(C)CC2)c2c1CC[C@@H](NS(=O)(=O)c1ccc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C24H31N3O4S/c1-17-3-7-22(27-11-9-26(2)10-12-27)21-15-18(4-6-20(17)21)25-32(28,29)19-5-8-23-24(16-19)31-14-13-30-23/h3,5,7-8,16,18,25H,4,6,9-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | JVNVLAKVSABDGC-GOSISDBHSA-N |
| XLogP | 2.35 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |