C23H27FN6O3 — CID 68960393
1-[2-[(3S,4S)-3-[(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-ylmethylamino)methyl]-4-hydroxypyrrolidin-1-yl]ethyl]-7-fluoro-1,5-naphthyridin-2-one (PubChem CID 68960393) has the molecular formula C23H27FN6O3 and a molecular weight of 454.51 g/mol. Its IUPAC name is 1-[2-[(3S,4S)-3-[(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-ylmethylamino)methyl]-4-hydroxypyrrolidin-1-yl]ethyl]-7-fluoro-1,5-naphthyridin-2-one.
| Compound Name | 1-[2-[(3S,4S)-3-[(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-ylmethylamino)methyl]-4-hydroxypyrrolidin-1-yl]ethyl]-7-fluoro-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 68960393 |
| Molecular Formula | C23H27FN6O3 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-[2-[(3S,4S)-3-[(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-ylmethylamino)methyl]-4-hydroxypyrrolidin-1-yl]ethyl]-7-fluoro-1,5-naphthyridin-2-one |
| SMILES | O=c1ccc2ncc(F)cc2n1CCN1C[C@H](CNCc2ccc3c(n2)NCCO3)[C@H](O)C1 |
| InChI | InChI=1S/C23H27FN6O3/c24-16-9-19-18(27-11-16)2-4-22(32)30(19)7-6-29-13-15(20(31)14-29)10-25-12-17-1-3-21-23(28-17)26-5-8-33-21/h1-4,9,11,15,20,25,31H,5-8,10,12-14H2,(H,26,28)/t15-,20+/m0/s1 |
| InChIKey | XEEKVQFDBLQNSS-MGPUTAFESA-N |
| XLogP | 0.82 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |