C48H62S6 — CID 68961225
2-[3-(3,4-dihexylthiophen-2-yl)-4,5-dithiophen-2-ylthiophen-2-yl]-4,5-dihexyl-3-thiophen-2-ylthiophene (PubChem CID 68961225) has the molecular formula C48H62S6 and a molecular weight of 831.43 g/mol. Its IUPAC name is 2-[3-(3,4-dihexylthiophen-2-yl)-4,5-dithiophen-2-ylthiophen-2-yl]-4,5-dihexyl-3-thiophen-2-ylthiophene.
| Compound Name | 2-[3-(3,4-dihexylthiophen-2-yl)-4,5-dithiophen-2-ylthiophen-2-yl]-4,5-dihexyl-3-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 68961225 |
| Molecular Formula | C48H62S6 |
| Molecular Weight | 831.43 g/mol |
| Exact Mass | 830.32 |
| IUPAC Name | 2-[3-(3,4-dihexylthiophen-2-yl)-4,5-dithiophen-2-ylthiophen-2-yl]-4,5-dihexyl-3-thiophen-2-ylthiophene |
| SMILES | CCCCCCc1csc(-c2c(-c3sc(CCCCCC)c(CCCCCC)c3-c3cccs3)sc(-c3cccs3)c2-c2cccs2)c1CCCCCC |
| InChI | InChI=1S/C48H62S6/c1-5-9-13-17-24-35-34-52-45(36(35)25-18-14-10-6-2)44-43(40-29-22-32-50-40)46(41-30-23-33-51-41)54-48(44)47-42(39-28-21-31-49-39)37(26-19-15-11-7-3)38(53-47)27-20-16-12-8-4/h21-23,28-34H,5-20,24-27H2,1-4H3 |
| InChIKey | SPWGQKXCGDDCTE-UHFFFAOYSA-N |
| XLogP | 18.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.43 |
| LogP ≤ 5 | 18.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|