C35H36FN7O4 — CID 68961371
(2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-[(1S,4S)-5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 68961371) has the molecular formula C35H36FN7O4 and a molecular weight of 637.72 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-[(1S,4S)-5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-[(1S,4S)-5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 68961371 |
| Molecular Formula | C35H36FN7O4 |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-[(1S,4S)-5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4C[C@@H]5C[C@H]4CN5c4ccc(F)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H36FN7O4/c36-23-11-13-24(14-12-23)41-17-26-15-25(41)18-42(26)35-39-32(37-16-27(21-7-3-1-4-8-21)22-9-5-2-6-10-22)29-33(40-35)43(20-38-29)34-31(46)30(45)28(19-44)47-34/h1-14,20,25-28,30-31,34,44-46H,15-19H2,(H,37,39,40)/t25-,26-,28+,30+,31+,34+/m0/s1 |
| InChIKey | ZJCZWJYFQMYRQO-WWPXMSPKSA-N |
| XLogP | 3.29 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |