About (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride
(3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride (PubChem CID 68961411) has the molecular formula C12H17BrCl2N2
and a molecular weight of 340.09 g/mol. Its IUPAC name is (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride |
| PubChem CID | 68961411 |
| Molecular Formula | C12H17BrCl2N2 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride |
| SMILES | C[C@@H]1CN(c2ccc(Cl)c(Br)c2)C[C@H](C)N1.Cl |
| InChI | InChI=1S/C12H16BrClN2.ClH/c1-8-6-16(7-9(2)15-8)10-3-4-12(14)11(13)5-10;/h3-5,8-9,15H,6-7H2,1-2H3;1H/t8-,9+; |
| InChIKey | PWAPJIMDKGRPLU-UFIFRZAQSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride?
The IUPAC name of (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride (CID 68961411) is (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride.
What is the SMILES notation for (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride?
The canonical SMILES for (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride is C[C@@H]1CN(c2ccc(Cl)c(Br)c2)C[C@H](C)N1.Cl.
What is the InChIKey of (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride?
The InChIKey is PWAPJIMDKGRPLU-UFIFRZAQSA-N. The full InChI is InChI=1S/C12H16BrClN2.ClH/c1-8-6-16(7-9(2)15-8)10-3-4-12(14)11(13)5-10;/h3-5,8-9,15H,6-7H2,1-2H3;1H/t8-,9+;.
What are the key properties of (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride?
(3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride has a molecular weight of 340.09 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-1-(3-bromo-4-chlorophenyl)-3,5-dimethylpiperazine;hydrochloride is sourced from PubChem (CID 68961411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).