C27H28O2 — CID 68961600
(4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[[4-(2-phenylethenyl)phenyl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68961600) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[[4-(2-phenylethenyl)phenyl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[[4-(2-phenylethenyl)phenyl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68961600 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[[4-(2-phenylethenyl)phenyl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC1=C2CCC[C@H](O)[C@@]2(C)CC(=Cc2ccc(C=Cc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C27H28O2/c1-19-24-9-6-10-25(28)27(24,2)18-23(26(19)29)17-22-15-13-21(14-16-22)12-11-20-7-4-3-5-8-20/h3-5,7-8,11-17,25,28H,6,9-10,18H2,1-2H3/t25-,27-/m0/s1 |
| InChIKey | QJYARJPGDZESST-BDYUSTAISA-N |
| XLogP | 6.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|