About 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile
5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile (PubChem CID 68961943) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile |
| PubChem CID | 68961943 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile |
| SMILES | N#CC1=NCC(CNc2ccccc2)N1 |
| InChI | InChI=1S/C11H12N4/c12-6-11-14-8-10(15-11)7-13-9-4-2-1-3-5-9/h1-5,10,13H,7-8H2,(H,14,15) |
| InChIKey | IKFCWBZFDOKQSI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile?
The IUPAC name of 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile (CID 68961943) is 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile.
What is the SMILES notation for 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile?
The canonical SMILES for 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile is N#CC1=NCC(CNc2ccccc2)N1.
What is the InChIKey of 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile?
The InChIKey is IKFCWBZFDOKQSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c12-6-11-14-8-10(15-11)7-13-9-4-2-1-3-5-9/h1-5,10,13H,7-8H2,(H,14,15).
What are the key properties of 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile?
5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile has a molecular weight of 200.25 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(anilinomethyl)-4,5-dihydro-1H-imidazole-2-carbonitrile is sourced from PubChem (CID 68961943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).