C20H26FN7O — CID 68962036
3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 68962036) has the molecular formula C20H26FN7O and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 68962036 |
| Molecular Formula | C20H26FN7O |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CN1CCN(CCCOc2ccc(-c3nn(C)c4nc(N)ncc34)cc2F)CC1 |
| InChI | InChI=1S/C20H26FN7O/c1-26-7-9-28(10-8-26)6-3-11-29-17-5-4-14(12-16(17)21)18-15-13-23-20(22)24-19(15)27(2)25-18/h4-5,12-13H,3,6-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | JOFZICSYCUPGPF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|