C22H26O2S — CID 68962661
(4R,4aS,5S)-5-hydroxy-4-methyl-3-[(4-methylsulfanylphenyl)methylidene]-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68962661) has the molecular formula C22H26O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is (4R,4aS,5S)-5-hydroxy-4-methyl-3-[(4-methylsulfanylphenyl)methylidene]-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4R,4aS,5S)-5-hydroxy-4-methyl-3-[(4-methylsulfanylphenyl)methylidene]-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68962661 |
| Molecular Formula | C22H26O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (4R,4aS,5S)-5-hydroxy-4-methyl-3-[(4-methylsulfanylphenyl)methylidene]-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C=CC[C@@]12C(=CC(=O)C(=Cc3ccc(SC)cc3)[C@@H]1C)CCC[C@@H]2O |
| InChI | InChI=1S/C22H26O2S/c1-4-12-22-15(2)19(13-16-8-10-18(25-3)11-9-16)20(23)14-17(22)6-5-7-21(22)24/h4,8-11,13-15,21,24H,1,5-7,12H2,2-3H3/t15-,21-,22-/m0/s1 |
| InChIKey | UCOSODKAILXNMF-RXYZOABWSA-N |
| XLogP | 5.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|