C17H30F3NOSSi — CID 68962757
(2S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfanylpropan-2-yl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-amine (PubChem CID 68962757) has the molecular formula C17H30F3NOSSi and a molecular weight of 381.58 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfanylpropan-2-yl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-amine.
| Compound Name | (2S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfanylpropan-2-yl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-amine |
|---|---|
| PubChem CID | 68962757 |
| Molecular Formula | C17H30F3NOSSi |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfanylpropan-2-yl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-amine |
| SMILES | CSC[C@@H](CO[Si](C)(C)C(C)(C)C)N[C@@H](C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C17H30F3NOSSi/c1-16(2,3)24(5,6)22-11-14(12-23-4)21-15(17(18,19)20)10-9-13-7-8-13/h13-15,21H,7-8,11-12H2,1-6H3/t14-,15+/m1/s1 |
| InChIKey | QWJWQIHNZJLRTA-CABCVRRESA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|