About (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine
(2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine (PubChem CID 68962761) has the molecular formula C18H17F4NOS
and a molecular weight of 371.40 g/mol. Its IUPAC name is (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine |
| PubChem CID | 68962761 |
| Molecular Formula | C18H17F4NOS |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine |
| SMILES | Fc1ccc([C@@]2(C(F)(F)F)N[C@@H](CSCc3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C18H17F4NOS/c19-15-8-6-14(7-9-15)17(18(20,21)22)23-16(10-24-17)12-25-11-13-4-2-1-3-5-13/h1-9,16,23H,10-12H2/t16-,17-/m1/s1 |
| InChIKey | HHPXTELUDJNWKQ-IAGOWNOFSA-N |
| XLogP | 4.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine?
The IUPAC name of (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine (CID 68962761) is (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine.
What is the SMILES notation for (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine?
The canonical SMILES for (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine is Fc1ccc([C@@]2(C(F)(F)F)N[C@@H](CSCc3ccccc3)CO2)cc1.
What is the InChIKey of (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine?
The InChIKey is HHPXTELUDJNWKQ-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H17F4NOS/c19-15-8-6-14(7-9-15)17(18(20,21)22)23-16(10-24-17)12-25-11-13-4-2-1-3-5-13/h1-9,16,23H,10-12H2/t16-,17-/m1/s1.
What are the key properties of (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine?
(2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine has a molecular weight of 371.40 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-4-(benzylsulfanylmethyl)-2-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-oxazolidine is sourced from PubChem (CID 68962761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).