C17H26O2 — CID 68963217
(4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68963217) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68963217 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CCC(C)C=C1C[C@@]2(C)C(=C(C)C1=O)CCC[C@@H]2O |
| InChI | InChI=1S/C17H26O2/c1-5-11(2)9-13-10-17(4)14(12(3)16(13)19)7-6-8-15(17)18/h9,11,15,18H,5-8,10H2,1-4H3/t11?,15-,17-/m0/s1 |
| InChIKey | JPFYUGDBKIPWBQ-NVHWHZRPSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|