C17H28O2 — CID 68963260
(3Z,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 68963260) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (3Z,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (3Z,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 68963260 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (3Z,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(2-methylbutylidene)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | CCC(C)/C=C1/C[C@@]2(C)C(CCC[C@@H]2O)C(C)C1=O |
| InChI | InChI=1S/C17H28O2/c1-5-11(2)9-13-10-17(4)14(12(3)16(13)19)7-6-8-15(17)18/h9,11-12,14-15,18H,5-8,10H2,1-4H3/b13-9-/t11?,12?,14?,15-,17-/m0/s1 |
| InChIKey | HHMGYLWVKWVOJK-FXMRHCFBSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|