C17H15F2NO3 — CID 68964004
2-[(2,5-difluorophenyl)methyl]-6,7-dimethoxy-3H-isoindol-1-one (PubChem CID 68964004) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-6,7-dimethoxy-3H-isoindol-1-one.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-6,7-dimethoxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 68964004 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-6,7-dimethoxy-3H-isoindol-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)N(Cc1cc(F)ccc1F)C2 |
| InChI | InChI=1S/C17H15F2NO3/c1-22-14-6-3-10-8-20(17(21)15(10)16(14)23-2)9-11-7-12(18)4-5-13(11)19/h3-7H,8-9H2,1-2H3 |
| InChIKey | KONRSVDNVJWPLI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |