C20H24O4 — CID 68964199
4-[[(5S,8aS)-6-hydroxy-5,8a-dimethyl-1-oxo-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene]methyl]benzoic acid (PubChem CID 68964199) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-[[(5S,8aS)-6-hydroxy-5,8a-dimethyl-1-oxo-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene]methyl]benzoic acid.
| Compound Name | 4-[[(5S,8aS)-6-hydroxy-5,8a-dimethyl-1-oxo-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 68964199 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-[[(5S,8aS)-6-hydroxy-5,8a-dimethyl-1-oxo-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-ylidene]methyl]benzoic acid |
| SMILES | C[C@@H]1C(O)CC[C@]2(C)C(=O)C(=Cc3ccc(C(=O)O)cc3)CCC12 |
| InChI | InChI=1S/C20H24O4/c1-12-16-8-7-15(18(22)20(16,2)10-9-17(12)21)11-13-3-5-14(6-4-13)19(23)24/h3-6,11-12,16-17,21H,7-10H2,1-2H3,(H,23,24)/t12-,16?,17?,20-/m0/s1 |
| InChIKey | XBNKPXQFVHLPIU-QPGFNDQGSA-N |
| XLogP | 3.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|