About benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid
benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid (PubChem CID 68964247) has the molecular formula C25H25NO3
and a molecular weight of 387.48 g/mol. Its IUPAC name is benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid.
Molecular Properties
| Compound Name | benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid |
| PubChem CID | 68964247 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid |
| SMILES | Cc1cccc(C)c1-c1cccc2c1OC(CN(Cc1ccccc1)C(=O)O)C2 |
| InChI | InChI=1S/C25H25NO3/c1-17-8-6-9-18(2)23(17)22-13-7-12-20-14-21(29-24(20)22)16-26(25(27)28)15-19-10-4-3-5-11-19/h3-13,21H,14-16H2,1-2H3,(H,27,28) |
| InChIKey | GZOGQJSEDLDDTG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid?
The IUPAC name of benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid (CID 68964247) is benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid.
What is the SMILES notation for benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid?
The canonical SMILES for benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid is Cc1cccc(C)c1-c1cccc2c1OC(CN(Cc1ccccc1)C(=O)O)C2.
What is the InChIKey of benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid?
The InChIKey is GZOGQJSEDLDDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO3/c1-17-8-6-9-18(2)23(17)22-13-7-12-20-14-21(29-24(20)22)16-26(25(27)28)15-19-10-4-3-5-11-19/h3-13,21H,14-16H2,1-2H3,(H,27,28).
What are the key properties of benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid?
benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid has a molecular weight of 387.48 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[[7-(2,6-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]carbamic acid is sourced from PubChem (CID 68964247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).