C22H26N2O2 — CID 68964276
5-[1-(4-cyanonaphthalen-1-yl)piperidin-4-yl]-3-methylpentanoic acid (PubChem CID 68964276) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 5-[1-(4-cyanonaphthalen-1-yl)piperidin-4-yl]-3-methylpentanoic acid.
| Compound Name | 5-[1-(4-cyanonaphthalen-1-yl)piperidin-4-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 68964276 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 5-[1-(4-cyanonaphthalen-1-yl)piperidin-4-yl]-3-methylpentanoic acid |
| SMILES | CC(CCC1CCN(c2ccc(C#N)c3ccccc23)CC1)CC(=O)O |
| InChI | InChI=1S/C22H26N2O2/c1-16(14-22(25)26)6-7-17-10-12-24(13-11-17)21-9-8-18(15-23)19-4-2-3-5-20(19)21/h2-5,8-9,16-17H,6-7,10-14H2,1H3,(H,25,26) |
| InChIKey | ODQSVBYNPCVLOT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |