C22H33NO — CID 68964431
(1S,8aR)-8a-benzyl-6-(diethylamino)-5-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol (PubChem CID 68964431) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (1S,8aR)-8a-benzyl-6-(diethylamino)-5-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol.
| Compound Name | (1S,8aR)-8a-benzyl-6-(diethylamino)-5-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 68964431 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (1S,8aR)-8a-benzyl-6-(diethylamino)-5-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol |
| SMILES | CCN(CC)C1CC[C@@]2(Cc3ccccc3)C(=C1C)CCC[C@@H]2O |
| InChI | InChI=1S/C22H33NO/c1-4-23(5-2)20-14-15-22(16-18-10-7-6-8-11-18)19(17(20)3)12-9-13-21(22)24/h6-8,10-11,20-21,24H,4-5,9,12-16H2,1-3H3/t20?,21-,22+/m0/s1 |
| InChIKey | QTJYQMJGFZSRRX-JTGIGXABSA-N |
| XLogP | 4.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|