About 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole
5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole (PubChem CID 68964482) has the molecular formula C13H11FN2
and a molecular weight of 214.24 g/mol. Its IUPAC name is 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole |
| PubChem CID | 68964482 |
| Molecular Formula | C13H11FN2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole |
| SMILES | Fc1ccc2c(c1)/C(=C\c1cnc[nH]1)CC2 |
| InChI | InChI=1S/C13H11FN2/c14-11-4-3-9-1-2-10(13(9)6-11)5-12-7-15-8-16-12/h3-8H,1-2H2,(H,15,16)/b10-5- |
| InChIKey | QCKSUYCANMZJOS-YHYXMXQVSA-N |
| XLogP | 3.04 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole?
The IUPAC name of 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole (CID 68964482) is 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole.
What is the SMILES notation for 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole?
The canonical SMILES for 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole is Fc1ccc2c(c1)/C(=C\c1cnc[nH]1)CC2.
What is the InChIKey of 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole?
The InChIKey is QCKSUYCANMZJOS-YHYXMXQVSA-N. The full InChI is InChI=1S/C13H11FN2/c14-11-4-3-9-1-2-10(13(9)6-11)5-12-7-15-8-16-12/h3-8H,1-2H2,(H,15,16)/b10-5-.
What are the key properties of 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole?
5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole has a molecular weight of 214.24 g/mol, XLogP of 3.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-(6-fluoro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole is sourced from PubChem (CID 68964482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).