About 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid
2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid (PubChem CID 68964643) has the molecular formula C15H22N2O5
and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid |
| PubChem CID | 68964643 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid |
| SMILES | CCCCC(C(=O)N1CCC[C@@H]1c1ncco1)C(O)C(=O)O |
| InChI | InChI=1S/C15H22N2O5/c1-2-3-5-10(12(18)15(20)21)14(19)17-8-4-6-11(17)13-16-7-9-22-13/h7,9-12,18H,2-6,8H2,1H3,(H,20,21)/t10?,11-,12?/m1/s1 |
| InChIKey | VHHUPKUOOKEIIC-MOENNCHZSA-N |
| XLogP | 1.59 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid?
The IUPAC name of 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid (CID 68964643) is 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid.
What is the SMILES notation for 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid?
The canonical SMILES for 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid is CCCCC(C(=O)N1CCC[C@@H]1c1ncco1)C(O)C(=O)O.
What is the InChIKey of 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid?
The InChIKey is VHHUPKUOOKEIIC-MOENNCHZSA-N. The full InChI is InChI=1S/C15H22N2O5/c1-2-3-5-10(12(18)15(20)21)14(19)17-8-4-6-11(17)13-16-7-9-22-13/h7,9-12,18H,2-6,8H2,1H3,(H,20,21)/t10?,11-,12?/m1/s1.
What are the key properties of 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid?
2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid has a molecular weight of 310.35 g/mol, XLogP of 1.59, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-[(2R)-2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanoic acid is sourced from PubChem (CID 68964643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).