C20H24O2 — CID 68964664
(3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(3-methylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68964664) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(3-methylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(3-methylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68964664 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(3-methylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC1=C2CCC[C@H](O)[C@@]2(C)C/C(=C\c2cccc(C)c2)C1=O |
| InChI | InChI=1S/C20H24O2/c1-13-6-4-7-15(10-13)11-16-12-20(3)17(14(2)19(16)22)8-5-9-18(20)21/h4,6-7,10-11,18,21H,5,8-9,12H2,1-3H3/b16-11+/t18-,20-/m0/s1 |
| InChIKey | AQYDZMVKJIMPFM-IVDQYXKXSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|