C19H21IO2 — CID 68964767
(4aS,5S)-5-hydroxy-3-[(4-iodophenyl)methylidene]-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68964767) has the molecular formula C19H21IO2 and a molecular weight of 408.28 g/mol. Its IUPAC name is (4aS,5S)-5-hydroxy-3-[(4-iodophenyl)methylidene]-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aS,5S)-5-hydroxy-3-[(4-iodophenyl)methylidene]-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68964767 |
| Molecular Formula | C19H21IO2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (4aS,5S)-5-hydroxy-3-[(4-iodophenyl)methylidene]-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC1=C2CCC[C@H](O)[C@@]2(C)CC(=Cc2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C19H21IO2/c1-12-16-4-3-5-17(21)19(16,2)11-14(18(12)22)10-13-6-8-15(20)9-7-13/h6-10,17,21H,3-5,11H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | OBZWWZHYZMOODI-HKUYNNGSSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|