C20H26O2S — CID 68965164
(2E,5S,8aS)-6-hydroxy-5,8a-dimethyl-2-[(4-methylsulfanylphenyl)methylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one (PubChem CID 68965164) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is (2E,5S,8aS)-6-hydroxy-5,8a-dimethyl-2-[(4-methylsulfanylphenyl)methylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one.
| Compound Name | (2E,5S,8aS)-6-hydroxy-5,8a-dimethyl-2-[(4-methylsulfanylphenyl)methylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 68965164 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2E,5S,8aS)-6-hydroxy-5,8a-dimethyl-2-[(4-methylsulfanylphenyl)methylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
| SMILES | CSc1ccc(/C=C2\CCC3[C@H](C)C(O)CC[C@]3(C)C2=O)cc1 |
| InChI | InChI=1S/C20H26O2S/c1-13-17-9-6-15(12-14-4-7-16(23-3)8-5-14)19(22)20(17,2)11-10-18(13)21/h4-5,7-8,12-13,17-18,21H,6,9-11H2,1-3H3/b15-12+/t13-,17?,18?,20-/m0/s1 |
| InChIKey | GHZRMKRITQCZBW-VURPGPQDSA-N |
| XLogP | 4.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|