C19H23ClO2 — CID 68965257
(3E,4aS,5S)-3-[(4-chlorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 68965257) has the molecular formula C19H23ClO2 and a molecular weight of 318.84 g/mol. Its IUPAC name is (3E,4aS,5S)-3-[(4-chlorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (3E,4aS,5S)-3-[(4-chlorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 68965257 |
| Molecular Formula | C19H23ClO2 |
| Molecular Weight | 318.84 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3E,4aS,5S)-3-[(4-chlorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | CC1C(=O)/C(=C/c2ccc(Cl)cc2)C[C@@]2(C)C1CCC[C@@H]2O |
| InChI | InChI=1S/C19H23ClO2/c1-12-16-4-3-5-17(21)19(16,2)11-14(18(12)22)10-13-6-8-15(20)9-7-13/h6-10,12,16-17,21H,3-5,11H2,1-2H3/b14-10+/t12?,16?,17-,19-/m0/s1 |
| InChIKey | DVUXALDNKXYEOT-SGWKEPJFSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|