C27H33NO3 — CID 68965305
(3S,7aS)-3-phenyl-7a-[4-(1-phenylmethoxyethyl)cyclohexyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 68965305) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3S,7aS)-3-phenyl-7a-[4-(1-phenylmethoxyethyl)cyclohexyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (3S,7aS)-3-phenyl-7a-[4-(1-phenylmethoxyethyl)cyclohexyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 68965305 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (3S,7aS)-3-phenyl-7a-[4-(1-phenylmethoxyethyl)cyclohexyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | CC(OCc1ccccc1)C1CCC([C@@]23CCC(=O)N2[C@@H](c2ccccc2)CO3)CC1 |
| InChI | InChI=1S/C27H33NO3/c1-20(30-18-21-8-4-2-5-9-21)22-12-14-24(15-13-22)27-17-16-26(29)28(27)25(19-31-27)23-10-6-3-7-11-23/h2-11,20,22,24-25H,12-19H2,1H3/t20?,22?,24?,25-,27+/m1/s1 |
| InChIKey | JMWHVWKKDDQOCS-YATPRQNBSA-N |
| XLogP | 5.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |