About cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone
cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone (PubChem CID 68965340) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone.
Molecular Properties
| Compound Name | cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone |
| PubChem CID | 68965340 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1=CC=CCC1)C1COCCO1 |
| InChI | InChI=1S/C11H14O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h1-2,4,10H,3,5-8H2 |
| InChIKey | PIYJNYHSPSUBQJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone?
The IUPAC name of cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone (CID 68965340) is cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone.
What is the SMILES notation for cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone?
The canonical SMILES for cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone is O=C(C1=CC=CCC1)C1COCCO1.
What is the InChIKey of cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone?
The InChIKey is PIYJNYHSPSUBQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h1-2,4,10H,3,5-8H2.
What are the key properties of cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone?
cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone has a molecular weight of 194.23 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-dien-1-yl(1,4-dioxan-2-yl)methanone is sourced from PubChem (CID 68965340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).