2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid

C8H13N3O3 — CID 68965575

IUPAC2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid
SMILESCC(C)c1noc(CCNC(=O)O)n1
InChIInChI=1S/C8H13N3O3/c1-5(2)7-10-6(14-11-7)3-4-9-8(12)13/h5,9H,3-4H2,1-2H3,(H,12,13)
InChIKeyBUPWMIJFMYEQFA-UHFFFAOYSA-N
MW199.21 g/mol
LogP1.00
Rot. Bonds4

About 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid

2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid (PubChem CID 68965575) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid.

Molecular Properties

Compound Name2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid
PubChem CID68965575
Molecular FormulaC8H13N3O3
Molecular Weight199.21 g/mol
Exact Mass199.10
IUPAC Name2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid
SMILESCC(C)c1noc(CCNC(=O)O)n1
InChIInChI=1S/C8H13N3O3/c1-5(2)7-10-6(14-11-7)3-4-9-8(12)13/h5,9H,3-4H2,1-2H3,(H,12,13)
InChIKeyBUPWMIJFMYEQFA-UHFFFAOYSA-N
XLogP1.00
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 51.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
The IUPAC name of 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid (CID 68965575) is 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid.
What is the SMILES notation for 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
The canonical SMILES for 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid is CC(C)c1noc(CCNC(=O)O)n1.
What is the InChIKey of 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
The InChIKey is BUPWMIJFMYEQFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-5(2)7-10-6(14-11-7)3-4-9-8(12)13/h5,9H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid?
2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid has a molecular weight of 199.21 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylcarbamic acid is sourced from PubChem (CID 68965575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).